C13H19N3 — CID 115195851
N-methyl-N'-[(2-methyl-1H-indol-3-yl)methyl]ethane-1,2-diamine (PubChem CID 115195851) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-methyl-N'-[(2-methyl-1H-indol-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[(2-methyl-1H-indol-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195851 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-methyl-N'-[(2-methyl-1H-indol-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CNCCNCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C13H19N3/c1-10-12(9-15-8-7-14-2)11-5-3-4-6-13(11)16-10/h3-6,14-16H,7-9H2,1-2H3 |
| InChIKey | FWDHBRPMWZDUEQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|