C11H25N3 — CID 115196067
N-methyl-N'-[2-(1-methylpiperidin-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 115196067) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N-methyl-N'-[2-(1-methylpiperidin-3-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[2-(1-methylpiperidin-3-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115196067 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N-methyl-N'-[2-(1-methylpiperidin-3-yl)ethyl]ethane-1,2-diamine |
| SMILES | CNCCNCCC1CCCN(C)C1 |
| InChI | InChI=1S/C11H25N3/c1-12-7-8-13-6-5-11-4-3-9-14(2)10-11/h11-13H,3-10H2,1-2H3 |
| InChIKey | RQMJEFQYBSJVQL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|