C25H25ClF3N5O4 — CID 11519647
3-(dimethylamino)propyl N-[2-chloro-5-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]phenyl]carbamate (PubChem CID 11519647) has the molecular formula C25H25ClF3N5O4 and a molecular weight of 551.95 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-[2-chloro-5-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]phenyl]carbamate.
| Compound Name | 3-(dimethylamino)propyl N-[2-chloro-5-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 11519647 |
| Molecular Formula | C25H25ClF3N5O4 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 3-(dimethylamino)propyl N-[2-chloro-5-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]phenyl]carbamate |
| SMILES | CN(C)CCCOC(=O)Nc1cc(N2C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)ccc1Cl |
| InChI | InChI=1S/C25H25ClF3N5O4/c1-24(2)21(35)33(16-7-6-15(14-30)18(12-16)25(27,28)29)23(37)34(24)17-8-9-19(26)20(13-17)31-22(36)38-11-5-10-32(3)4/h6-9,12-13H,5,10-11H2,1-4H3,(H,31,36) |
| InChIKey | XIKHPRJPXMDHLU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|