C12H17N3OS — CID 115196564
6-[(2-aminopropylamino)methyl]-4H-1,4-benzothiazin-3-one (PubChem CID 115196564) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is 6-[(2-aminopropylamino)methyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(2-aminopropylamino)methyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115196564 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 6-[(2-aminopropylamino)methyl]-4H-1,4-benzothiazin-3-one |
| SMILES | CC(N)CNCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H17N3OS/c1-8(13)5-14-6-9-2-3-11-10(4-9)15-12(16)7-17-11/h2-4,8,14H,5-7,13H2,1H3,(H,15,16) |
| InChIKey | UUVCAECOHCHGRD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |