C16H22N2 — CID 115197005
1-N-methyl-1-N-(2-naphthalen-2-ylethyl)propane-1,2-diamine (PubChem CID 115197005) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-N-methyl-1-N-(2-naphthalen-2-ylethyl)propane-1,2-diamine.
| Compound Name | 1-N-methyl-1-N-(2-naphthalen-2-ylethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115197005 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-N-methyl-1-N-(2-naphthalen-2-ylethyl)propane-1,2-diamine |
| SMILES | CC(N)CN(C)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H22N2/c1-13(17)12-18(2)10-9-14-7-8-15-5-3-4-6-16(15)11-14/h3-8,11,13H,9-10,12,17H2,1-2H3 |
| InChIKey | FCZYKKFMVPDVCL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |