C25H45IO4Si — CID 11519743
(E,2R)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-[(1R,2S,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hept-4-en-3-ol (PubChem CID 11519743) has the molecular formula C25H45IO4Si and a molecular weight of 564.62 g/mol. Its IUPAC name is (E,2R)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-[(1R,2S,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hept-4-en-3-ol.
| Compound Name | (E,2R)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-[(1R,2S,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hept-4-en-3-ol |
|---|---|
| PubChem CID | 11519743 |
| Molecular Formula | C25H45IO4Si |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | (E,2R)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-[(1R,2S,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hept-4-en-3-ol |
| SMILES | C=C(C)[C@@H]1CC(C)=C[C@@H](OCOC)[C@H]1[C@@H](C)C(O)/C=C(/I)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H45IO4Si/c1-17(2)21-13-18(3)14-23(29-16-28-8)24(21)19(4)22(27)15-20(26)11-12-30-31(9,10)25(5,6)7/h14-15,19,21-24,27H,1,11-13,16H2,2-10H3/b20-15+/t19-,21-,22?,23+,24-/m0/s1 |
| InChIKey | XXVDWTAMLVARKV-FICZZSHESA-N |
| XLogP | 6.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|