About N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine
N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine (PubChem CID 115197652) has the molecular formula C8H13ClN2S
and a molecular weight of 204.73 g/mol. Its IUPAC name is N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine |
| PubChem CID | 115197652 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2S/c1-10-5-2-6-11-8-4-3-7(9)12-8/h3-4,10-11H,2,5-6H2,1H3 |
| InChIKey | HBWXTKKQLMYINS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine?
The IUPAC name of N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine (CID 115197652) is N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine?
The canonical SMILES for N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine is CNCCCNc1ccc(Cl)s1.
What is the InChIKey of N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine?
The InChIKey is HBWXTKKQLMYINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2S/c1-10-5-2-6-11-8-4-3-7(9)12-8/h3-4,10-11H,2,5-6H2,1H3.
What are the key properties of N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine?
N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine has a molecular weight of 204.73 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chlorothiophen-2-yl)-N-methylpropane-1,3-diamine is sourced from PubChem (CID 115197652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).