C28H23F6N5O2 — CID 11519825
6-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-9-(trifluoromethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-1,8-naphthyridino[3,4-b][1,4]benzoxazine (PubChem CID 11519825) has the molecular formula C28H23F6N5O2 and a molecular weight of 575.51 g/mol. Its IUPAC name is 6-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-9-(trifluoromethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-1,8-naphthyridino[3,4-b][1,4]benzoxazine.
| Compound Name | 6-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-9-(trifluoromethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-1,8-naphthyridino[3,4-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 11519825 |
| Molecular Formula | C28H23F6N5O2 |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 6-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-9-(trifluoromethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-1,8-naphthyridino[3,4-b][1,4]benzoxazine |
| SMILES | C[C@@H]1CN(Cc2nc3nc(-c4ncccc4C(F)(F)F)ccc3c3c2Oc2cc(C(F)(F)F)ccc2N3)C[C@H](C)O1 |
| InChI | InChI=1S/C28H23F6N5O2/c1-14-11-39(12-15(2)40-14)13-21-25-23(36-19-7-5-16(27(29,30)31)10-22(19)41-25)17-6-8-20(37-26(17)38-21)24-18(28(32,33)34)4-3-9-35-24/h3-10,14-15,36H,11-13H2,1-2H3/t14-,15+ |
| InChIKey | OFOXHONCMLJBGS-GASCZTMLSA-N |
| XLogP | 7.19 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |