C23H19F3N2O6S2 — CID 11519842
2-[(5Z)-5-[[4-[4-[(2S)-2-amino-3-methoxy-3-oxopropyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 11519842) has the molecular formula C23H19F3N2O6S2 and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[4-[(2S)-2-amino-3-methoxy-3-oxopropyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[4-[(2S)-2-amino-3-methoxy-3-oxopropyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 11519842 |
| Molecular Formula | C23H19F3N2O6S2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 2-[(5Z)-5-[[4-[4-[(2S)-2-amino-3-methoxy-3-oxopropyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(Oc2ccc(/C=C3\SC(=S)N(CC(=O)O)C3=O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F3N2O6S2/c1-33-21(32)16(27)9-12-2-5-14(6-3-12)34-17-7-4-13(8-15(17)23(24,25)26)10-18-20(31)28(11-19(29)30)22(35)36-18/h2-8,10,16H,9,11,27H2,1H3,(H,29,30)/b18-10-/t16-/m0/s1 |
| InChIKey | NEPYLYVNPQZKJN-PMFHANACSA-N |
| XLogP | 3.83 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|