C35H56O7 — CID 11519926
13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-1-[(2R,5R)-5-[(2R,5R)-5-nonanoyloxolan-2-yl]oxolan-2-yl]tridecane-1,6-dione (PubChem CID 11519926) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is 13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-1-[(2R,5R)-5-[(2R,5R)-5-nonanoyloxolan-2-yl]oxolan-2-yl]tridecane-1,6-dione.
| Compound Name | 13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-1-[(2R,5R)-5-[(2R,5R)-5-nonanoyloxolan-2-yl]oxolan-2-yl]tridecane-1,6-dione |
|---|---|
| PubChem CID | 11519926 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | 13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-1-[(2R,5R)-5-[(2R,5R)-5-nonanoyloxolan-2-yl]oxolan-2-yl]tridecane-1,6-dione |
| SMILES | CCCCCCCCC(=O)[C@H]1CC[C@H]([C@H]2CC[C@H](C(=O)CCCCC(=O)CCCCCCCC3=C[C@H](C)OC3=O)O2)O1 |
| InChI | InChI=1S/C35H56O7/c1-3-4-5-6-10-13-19-29(37)31-21-23-33(41-31)34-24-22-32(42-34)30(38)20-15-14-18-28(36)17-12-9-7-8-11-16-27-25-26(2)40-35(27)39/h25-26,31-34H,3-24H2,1-2H3/t26-,31+,32+,33+,34+/m0/s1 |
| InChIKey | PXUBYPRATJNSMT-DNXIPZLOSA-N |
| XLogP | 7.70 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|