About N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine
N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine (PubChem CID 115201141) has the molecular formula C14H24N2S
and a molecular weight of 252.43 g/mol. Its IUPAC name is N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine |
| PubChem CID | 115201141 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine |
| SMILES | CC(C)Sc1ccc(N(C)CCCCN)cc1 |
| InChI | InChI=1S/C14H24N2S/c1-12(2)17-14-8-6-13(7-9-14)16(3)11-5-4-10-15/h6-9,12H,4-5,10-11,15H2,1-3H3 |
| InChIKey | JGRUZSGGKKLOLQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine?
The IUPAC name of N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine (CID 115201141) is N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine.
What is the SMILES notation for N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine?
The canonical SMILES for N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine is CC(C)Sc1ccc(N(C)CCCCN)cc1.
What is the InChIKey of N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine?
The InChIKey is JGRUZSGGKKLOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S/c1-12(2)17-14-8-6-13(7-9-14)16(3)11-5-4-10-15/h6-9,12H,4-5,10-11,15H2,1-3H3.
What are the key properties of N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine?
N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine has a molecular weight of 252.43 g/mol, XLogP of 3.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine is sourced from PubChem (CID 115201141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).