C28H36Cl3NO7Si — CID 11520161
2,2,2-trichloroethyl N-[(4aR,6R,7R,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 11520161) has the molecular formula C28H36Cl3NO7Si and a molecular weight of 633.04 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(4aR,6R,7R,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(4aR,6R,7R,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 11520161 |
| Molecular Formula | C28H36Cl3NO7Si |
| Molecular Weight | 633.04 g/mol |
| Exact Mass | 631.13 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(4aR,6R,7R,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | CC1(C)OC[C@H]2O[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](NC(=O)OCC(Cl)(Cl)Cl)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C28H36Cl3NO7Si/c1-26(2,3)40(18-12-8-6-9-13-18,19-14-10-7-11-15-19)39-24-21(32-25(34)35-17-28(29,30)31)22(33)23-20(37-24)16-36-27(4,5)38-23/h6-15,20-24,33H,16-17H2,1-5H3,(H,32,34)/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | XFAPAMREQLQIHP-MRKXFKPJSA-N |
| XLogP | 4.27 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|