C12H20N2O2S — CID 115201713
N-methyl-N'-(4-methylsulfonylphenyl)butane-1,4-diamine (PubChem CID 115201713) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-methyl-N'-(4-methylsulfonylphenyl)butane-1,4-diamine.
| Compound Name | N-methyl-N'-(4-methylsulfonylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115201713 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-methyl-N'-(4-methylsulfonylphenyl)butane-1,4-diamine |
| SMILES | CNCCCCNc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-13-9-3-4-10-14-11-5-7-12(8-6-11)17(2,15)16/h5-8,13-14H,3-4,9-10H2,1-2H3 |
| InChIKey | JJZJWOZGKAQDBC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|