About N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine
N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine (PubChem CID 115202509) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine |
| PubChem CID | 115202509 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine |
| SMILES | Cc1ccsc1N(C)CC(C)CCN |
| InChI | InChI=1S/C11H20N2S/c1-9(4-6-12)8-13(3)11-10(2)5-7-14-11/h5,7,9H,4,6,8,12H2,1-3H3 |
| InChIKey | IKPVJUZFTKOZBQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine?
The IUPAC name of N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine (CID 115202509) is N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine.
What is the SMILES notation for N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine?
The canonical SMILES for N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine is Cc1ccsc1N(C)CC(C)CCN.
What is the InChIKey of N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine?
The InChIKey is IKPVJUZFTKOZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-9(4-6-12)8-13(3)11-10(2)5-7-14-11/h5,7,9H,4,6,8,12H2,1-3H3.
What are the key properties of N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine?
N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine has a molecular weight of 212.36 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-(3-methylthiophen-2-yl)butane-1,4-diamine is sourced from PubChem (CID 115202509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).