C17H24N2 — CID 115202803
2-methyl-N-(2-naphthalen-1-ylethyl)butane-1,4-diamine (PubChem CID 115202803) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-methyl-N-(2-naphthalen-1-ylethyl)butane-1,4-diamine.
| Compound Name | 2-methyl-N-(2-naphthalen-1-ylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115202803 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-methyl-N-(2-naphthalen-1-ylethyl)butane-1,4-diamine |
| SMILES | CC(CCN)CNCCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H24N2/c1-14(9-11-18)13-19-12-10-16-7-4-6-15-5-2-3-8-17(15)16/h2-8,14,19H,9-13,18H2,1H3 |
| InChIKey | SCSNFYVBQDDHGN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|