C13H21ClN2O — CID 115202949
N'-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine (PubChem CID 115202949) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is N'-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine.
| Compound Name | N'-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115202949 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N'-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine |
| SMILES | CCOc1ccc(NCCC(C)CN)cc1Cl |
| InChI | InChI=1S/C13H21ClN2O/c1-3-17-13-5-4-11(8-12(13)14)16-7-6-10(2)9-15/h4-5,8,10,16H,3,6-7,9,15H2,1-2H3 |
| InChIKey | FIMBRMLESUTJIU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|