About 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine
2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine (PubChem CID 115203408) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine |
| PubChem CID | 115203408 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine |
| SMILES | Cc1nc2ccc(CCNCCC(C)CN)cc2o1 |
| InChI | InChI=1S/C15H23N3O/c1-11(10-16)5-7-17-8-6-13-3-4-14-15(9-13)19-12(2)18-14/h3-4,9,11,17H,5-8,10,16H2,1-2H3 |
| InChIKey | XQXOVWYKAJCNAL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine?
The IUPAC name of 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine (CID 115203408) is 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine.
What is the SMILES notation for 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine?
The canonical SMILES for 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine is Cc1nc2ccc(CCNCCC(C)CN)cc2o1.
What is the InChIKey of 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine?
The InChIKey is XQXOVWYKAJCNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-11(10-16)5-7-17-8-6-13-3-4-14-15(9-13)19-12(2)18-14/h3-4,9,11,17H,5-8,10,16H2,1-2H3.
What are the key properties of 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine?
2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine has a molecular weight of 261.37 g/mol, XLogP of 2.25, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-[2-(2-methyl-1,3-benzoxazol-6-yl)ethyl]butane-1,4-diamine is sourced from PubChem (CID 115203408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).