C27H29Cl2N7O8S — CID 11520382
(E)-3-(2,4-dichlorophenyl)-N-methylprop-2-enamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide (PubChem CID 11520382) has the molecular formula C27H29Cl2N7O8S and a molecular weight of 682.54 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-methylprop-2-enamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-methylprop-2-enamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 11520382 |
| Molecular Formula | C27H29Cl2N7O8S |
| Molecular Weight | 682.54 g/mol |
| Exact Mass | 681.12 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-methylprop-2-enamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide |
| SMILES | CNC(=O)/C=C/c1ccc(Cl)cc1Cl.COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cc(NC=O)ccc2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C17H20N6O7S.C10H9Cl2NO/c1-23(2)15(25)11-6-5-10(18-9-24)7-12(11)31(27,28)22-17(26)21-16-19-13(29-3)8-14(20-16)30-4;1-13-10(14)5-3-7-2-4-8(11)6-9(7)12/h5-9H,1-4H3,(H,18,24)(H2,19,20,21,22,26);2-6H,1H3,(H,13,14)/b;5-3+ |
| InChIKey | NDIAHMTWPCWRMM-GWDXERMASA-N |
| XLogP | 3.03 |
| TPSA | 198.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|