C16H14F15N5O4S2 — CID 11520408
bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-(pyrazol-1-ylmethyl)imidazol-3-ium (PubChem CID 11520408) has the molecular formula C16H14F15N5O4S2 and a molecular weight of 689.42 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-(pyrazol-1-ylmethyl)imidazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-(pyrazol-1-ylmethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 11520408 |
| Molecular Formula | C16H14F15N5O4S2 |
| Molecular Weight | 689.42 g/mol |
| Exact Mass | 689.02 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-(pyrazol-1-ylmethyl)imidazol-3-ium |
| SMILES | Cc1n(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc[n+]1Cn1cccn1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H14F9N4.C2F6NO4S2/c1-10-25(7-8-26(10)9-27-5-2-4-24-27)6-3-11(15,16)12(17,18)13(19,20)14(21,22)23;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2,4-5,7-8H,3,6,9H2,1H3;/q+1;-1 |
| InChIKey | YFCJRTNZETYAFX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|