C15H33N3 — CID 115204173
1-N-[2-methyl-2-(1-methylpiperidin-4-yl)propyl]pentane-1,4-diamine (PubChem CID 115204173) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-N-[2-methyl-2-(1-methylpiperidin-4-yl)propyl]pentane-1,4-diamine.
| Compound Name | 1-N-[2-methyl-2-(1-methylpiperidin-4-yl)propyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 115204173 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 1-N-[2-methyl-2-(1-methylpiperidin-4-yl)propyl]pentane-1,4-diamine |
| SMILES | CC(N)CCCNCC(C)(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C15H33N3/c1-13(16)6-5-9-17-12-15(2,3)14-7-10-18(4)11-8-14/h13-14,17H,5-12,16H2,1-4H3 |
| InChIKey | WLQOKKRVEDCZMH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|