C12H18ClFN2 — CID 115205164
1-N-(5-chloro-2-fluorophenyl)-4-methylpentane-1,4-diamine (PubChem CID 115205164) has the molecular formula C12H18ClFN2 and a molecular weight of 244.74 g/mol. Its IUPAC name is 1-N-(5-chloro-2-fluorophenyl)-4-methylpentane-1,4-diamine.
| Compound Name | 1-N-(5-chloro-2-fluorophenyl)-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 115205164 |
| Molecular Formula | C12H18ClFN2 |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-N-(5-chloro-2-fluorophenyl)-4-methylpentane-1,4-diamine |
| SMILES | CC(C)(N)CCCNc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H18ClFN2/c1-12(2,15)6-3-7-16-11-8-9(13)4-5-10(11)14/h4-5,8,16H,3,6-7,15H2,1-2H3 |
| InChIKey | PLAWNCDLVAKHEC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|