C14H21N3O — CID 115205939
N-ethyl-N'-methyl-N'-[(2-methyl-1,3-benzoxazol-6-yl)methyl]ethane-1,2-diamine (PubChem CID 115205939) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(2-methyl-1,3-benzoxazol-6-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[(2-methyl-1,3-benzoxazol-6-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115205939 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(2-methyl-1,3-benzoxazol-6-yl)methyl]ethane-1,2-diamine |
| SMILES | CCNCCN(C)Cc1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C14H21N3O/c1-4-15-7-8-17(3)10-12-5-6-13-14(9-12)18-11(2)16-13/h5-6,9,15H,4,7-8,10H2,1-3H3 |
| InChIKey | QPCDSVYGLFUMEM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|