C20H44O12P2PtS4 — CID 11520753
bis(bis[2-(2-methoxyethoxy)ethoxy]-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) (PubChem CID 11520753) has the molecular formula C20H44O12P2PtS4 and a molecular weight of 861.85 g/mol. Its IUPAC name is bis(bis[2-(2-methoxyethoxy)ethoxy]-sulfanylidene-sulfido-λ5-phosphane);platinum(2+).
| Compound Name | bis(bis[2-(2-methoxyethoxy)ethoxy]-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
|---|---|
| PubChem CID | 11520753 |
| Molecular Formula | C20H44O12P2PtS4 |
| Molecular Weight | 861.85 g/mol |
| Exact Mass | 861.08 |
| IUPAC Name | bis(bis[2-(2-methoxyethoxy)ethoxy]-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
| SMILES | COCCOCCOP(=S)([S-])OCCOCCOC.COCCOCCOP(=S)([S-])OCCOCCOC.[Pt+2] |
| InChI | InChI=1S/2C10H23O6PS2.Pt/c2*1-11-3-5-13-7-9-15-17(18,19)16-10-8-14-6-4-12-2;/h2*3-10H2,1-2H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | ZKJKKCQEEKIOSF-UHFFFAOYSA-L |
| XLogP | 2.23 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.85 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|