C12H17BrN2 — CID 115208623
5-bromo-2-methyl-N-(pyrrolidin-3-ylmethyl)aniline (PubChem CID 115208623) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(pyrrolidin-3-ylmethyl)aniline.
| Compound Name | 5-bromo-2-methyl-N-(pyrrolidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 115208623 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-bromo-2-methyl-N-(pyrrolidin-3-ylmethyl)aniline |
| SMILES | Cc1ccc(Br)cc1NCC1CCNC1 |
| InChI | InChI=1S/C12H17BrN2/c1-9-2-3-11(13)6-12(9)15-8-10-4-5-14-7-10/h2-3,6,10,14-15H,4-5,7-8H2,1H3 |
| InChIKey | PMTMUCXMHSVYPB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |