C17H28N2 — CID 115208714
4-tert-butyl-N,2-dimethyl-N-(pyrrolidin-3-ylmethyl)aniline (PubChem CID 115208714) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 4-tert-butyl-N,2-dimethyl-N-(pyrrolidin-3-ylmethyl)aniline.
| Compound Name | 4-tert-butyl-N,2-dimethyl-N-(pyrrolidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 115208714 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 4-tert-butyl-N,2-dimethyl-N-(pyrrolidin-3-ylmethyl)aniline |
| SMILES | Cc1cc(C(C)(C)C)ccc1N(C)CC1CCNC1 |
| InChI | InChI=1S/C17H28N2/c1-13-10-15(17(2,3)4)6-7-16(13)19(5)12-14-8-9-18-11-14/h6-7,10,14,18H,8-9,11-12H2,1-5H3 |
| InChIKey | MHCJXXNRXKXVEW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |