C14H23N3 — CID 115209149
2-methyl-2-pyridin-3-yl-N-(pyrrolidin-3-ylmethyl)propan-1-amine (PubChem CID 115209149) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-methyl-2-pyridin-3-yl-N-(pyrrolidin-3-ylmethyl)propan-1-amine.
| Compound Name | 2-methyl-2-pyridin-3-yl-N-(pyrrolidin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115209149 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-methyl-2-pyridin-3-yl-N-(pyrrolidin-3-ylmethyl)propan-1-amine |
| SMILES | CC(C)(CNCC1CCNC1)c1cccnc1 |
| InChI | InChI=1S/C14H23N3/c1-14(2,13-4-3-6-15-10-13)11-17-9-12-5-7-16-8-12/h3-4,6,10,12,16-17H,5,7-9,11H2,1-2H3 |
| InChIKey | NBGIKDYVGDUNLZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |