C14H19N3O2 — CID 115209824
6-amino-4-(piperidin-4-ylmethyl)-1,4-benzoxazin-3-one (PubChem CID 115209824) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-amino-4-(piperidin-4-ylmethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-(piperidin-4-ylmethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115209824 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-amino-4-(piperidin-4-ylmethyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(CC1CCNCC1)C(=O)CO2 |
| InChI | InChI=1S/C14H19N3O2/c15-11-1-2-13-12(7-11)17(14(18)9-19-13)8-10-3-5-16-6-4-10/h1-2,7,10,16H,3-6,8-9,15H2 |
| InChIKey | BDSDEWISOGFBOR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|