C18H24N2 — CID 115209974
N-[(6-methylnaphthalen-2-yl)methyl]-1-piperidin-4-ylmethanamine (PubChem CID 115209974) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[(6-methylnaphthalen-2-yl)methyl]-1-piperidin-4-ylmethanamine.
| Compound Name | N-[(6-methylnaphthalen-2-yl)methyl]-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 115209974 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-[(6-methylnaphthalen-2-yl)methyl]-1-piperidin-4-ylmethanamine |
| SMILES | Cc1ccc2cc(CNCC3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C18H24N2/c1-14-2-4-18-11-16(3-5-17(18)10-14)13-20-12-15-6-8-19-9-7-15/h2-5,10-11,15,19-20H,6-9,12-13H2,1H3 |
| InChIKey | WVTIRNQBYOVWLW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |