C11H19N3 — CID 115210229
N-methyl-N-(2-pyrrolidin-2-ylethyl)-1H-pyrrol-3-amine (PubChem CID 115210229) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-methyl-N-(2-pyrrolidin-2-ylethyl)-1H-pyrrol-3-amine.
| Compound Name | N-methyl-N-(2-pyrrolidin-2-ylethyl)-1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 115210229 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-methyl-N-(2-pyrrolidin-2-ylethyl)-1H-pyrrol-3-amine |
| SMILES | CN(CCC1CCCN1)c1cc[nH]c1 |
| InChI | InChI=1S/C11H19N3/c1-14(11-4-7-12-9-11)8-5-10-3-2-6-13-10/h4,7,9-10,12-13H,2-3,5-6,8H2,1H3 |
| InChIKey | HDPZAIFIYLMGKC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |