About CID 11521033
CID 11521033 (PubChem CID 11521033) has the molecular formula C33H29O5
and a molecular weight of 505.59 g/mol.
Molecular Properties
| Compound Name | CID 11521033 |
| PubChem CID | 11521033 |
| Molecular Formula | C33H29O5 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | — |
| SMILES | COc1ccc([C]2[C](O)[C](c3ccc(OC)cc3)[C](c3ccc(OC)cc3)[C]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H29O5/c1-35-25-13-5-21(6-14-25)29-30(22-7-15-26(36-2)16-8-22)32(24-11-19-28(38-4)20-12-24)33(34)31(29)23-9-17-27(37-3)18-10-23/h5-20,34H,1-4H3 |
| InChIKey | NHWSJLUBUGRFRR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 11521033 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11521033?
The IUPAC name of CID 11521033 (CID 11521033) is not available.
What is the SMILES notation for CID 11521033?
The canonical SMILES for CID 11521033 is COc1ccc([C]2[C](O)[C](c3ccc(OC)cc3)[C](c3ccc(OC)cc3)[C]2c2ccc(OC)cc2)cc1.
What is the InChIKey of CID 11521033?
The InChIKey is NHWSJLUBUGRFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H29O5/c1-35-25-13-5-21(6-14-25)29-30(22-7-15-26(36-2)16-8-22)32(24-11-19-28(38-4)20-12-24)33(34)31(29)23-9-17-27(37-3)18-10-23/h5-20,34H,1-4H3.
What are the key properties of CID 11521033?
CID 11521033 has a molecular weight of 505.59 g/mol, XLogP of 6.43, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11521033 is sourced from PubChem (CID 11521033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).