About 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde
1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde (PubChem CID 11521165) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde |
| PubChem CID | 11521165 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1O)CC=CC2 |
| InChI | InChI=1S/C11H10O2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-2,5-7,13H,3-4H2 |
| InChIKey | YZIRPLHWBLYCDD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde?
The IUPAC name of 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde (CID 11521165) is 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde.
What is the SMILES notation for 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde?
The canonical SMILES for 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde is O=Cc1ccc2c(c1O)CC=CC2.
What is the InChIKey of 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde?
The InChIKey is YZIRPLHWBLYCDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-2,5-7,13H,3-4H2.
What are the key properties of 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde?
1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde has a molecular weight of 174.20 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5,8-dihydronaphthalene-2-carbaldehyde is sourced from PubChem (CID 11521165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).