C16H20N2O — CID 115211786
N-[(3-aminophenyl)methyl]-4-methoxy-2,3-dimethylaniline (PubChem CID 115211786) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-4-methoxy-2,3-dimethylaniline.
| Compound Name | N-[(3-aminophenyl)methyl]-4-methoxy-2,3-dimethylaniline |
|---|---|
| PubChem CID | 115211786 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-4-methoxy-2,3-dimethylaniline |
| SMILES | COc1ccc(NCc2cccc(N)c2)c(C)c1C |
| InChI | InChI=1S/C16H20N2O/c1-11-12(2)16(19-3)8-7-15(11)18-10-13-5-4-6-14(17)9-13/h4-9,18H,10,17H2,1-3H3 |
| InChIKey | IILSLRHVUMCNCW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|