C8H11N3OS — CID 11521257
(3R,6R,7aS)-6-amino-6-methyl-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile (PubChem CID 11521257) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is (3R,6R,7aS)-6-amino-6-methyl-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile.
| Compound Name | (3R,6R,7aS)-6-amino-6-methyl-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
|---|---|
| PubChem CID | 11521257 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (3R,6R,7aS)-6-amino-6-methyl-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
| SMILES | C[C@@]1(N)C[C@@H]2SC[C@@H](C#N)N2C1=O |
| InChI | InChI=1S/C8H11N3OS/c1-8(10)2-6-11(7(8)12)5(3-9)4-13-6/h5-6H,2,4,10H2,1H3/t5-,6+,8-/m1/s1 |
| InChIKey | VPADDFZLWGIZLD-GKROBHDKSA-N |
| XLogP | -0.10 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |