C13H18O2 — CID 11521304
1,4-diethyl-5,6,7,8-tetrahydroisochromen-3-one (PubChem CID 11521304) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,4-diethyl-5,6,7,8-tetrahydroisochromen-3-one.
| Compound Name | 1,4-diethyl-5,6,7,8-tetrahydroisochromen-3-one |
|---|---|
| PubChem CID | 11521304 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1,4-diethyl-5,6,7,8-tetrahydroisochromen-3-one |
| SMILES | CCc1oc(=O)c(CC)c2c1CCCC2 |
| InChI | InChI=1S/C13H18O2/c1-3-9-10-7-5-6-8-11(10)12(4-2)15-13(9)14/h3-8H2,1-2H3 |
| InChIKey | DYHGJVMDDBWIQY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |