About 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane
2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane (PubChem CID 11521331) has the molecular formula C6H14N2O4S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane |
| PubChem CID | 11521331 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane |
| SMILES | CC1(C)OCC(CNS(N)(=O)=O)O1 |
| InChI | InChI=1S/C6H14N2O4S/c1-6(2)11-4-5(12-6)3-8-13(7,9)10/h5,8H,3-4H2,1-2H3,(H2,7,9,10) |
| InChIKey | QEFKDOMMJXOMQV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane?
The IUPAC name of 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane (CID 11521331) is 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane.
What is the SMILES notation for 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane?
The canonical SMILES for 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane is CC1(C)OCC(CNS(N)(=O)=O)O1.
What is the InChIKey of 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane?
The InChIKey is QEFKDOMMJXOMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O4S/c1-6(2)11-4-5(12-6)3-8-13(7,9)10/h5,8H,3-4H2,1-2H3,(H2,7,9,10).
What are the key properties of 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane?
2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane has a molecular weight of 210.25 g/mol, XLogP of -1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-[(sulfamoylamino)methyl]-1,3-dioxolane is sourced from PubChem (CID 11521331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).