C16H28N2O — CID 115213752
N-methyl-4-[[methyl-[2-(5-methylfuran-2-yl)ethyl]amino]methyl]cyclohexan-1-amine (PubChem CID 115213752) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-methyl-4-[[methyl-[2-(5-methylfuran-2-yl)ethyl]amino]methyl]cyclohexan-1-amine.
| Compound Name | N-methyl-4-[[methyl-[2-(5-methylfuran-2-yl)ethyl]amino]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 115213752 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-methyl-4-[[methyl-[2-(5-methylfuran-2-yl)ethyl]amino]methyl]cyclohexan-1-amine |
| SMILES | CNC1CCC(CN(C)CCc2ccc(C)o2)CC1 |
| InChI | InChI=1S/C16H28N2O/c1-13-4-9-16(19-13)10-11-18(3)12-14-5-7-15(17-2)8-6-14/h4,9,14-15,17H,5-8,10-12H2,1-3H3 |
| InChIKey | DVNVTKHSWRZIFF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |