C9H15ClN2 — CID 115215195
N-(2-chloroethyl)-N-methyl-2-(1H-pyrrol-3-yl)ethanamine (PubChem CID 115215195) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-methyl-2-(1H-pyrrol-3-yl)ethanamine.
| Compound Name | N-(2-chloroethyl)-N-methyl-2-(1H-pyrrol-3-yl)ethanamine |
|---|---|
| PubChem CID | 115215195 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-(2-chloroethyl)-N-methyl-2-(1H-pyrrol-3-yl)ethanamine |
| SMILES | CN(CCCl)CCc1cc[nH]c1 |
| InChI | InChI=1S/C9H15ClN2/c1-12(7-4-10)6-3-9-2-5-11-8-9/h2,5,8,11H,3-4,6-7H2,1H3 |
| InChIKey | MZGJQFQJTPBXFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|