C16H20O2 — CID 11521602
(6S,10aS)-6-prop-1-en-2-yl-2,3,4,5,6,7,8,10a-octahydroxanthen-1-one (PubChem CID 11521602) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (6S,10aS)-6-prop-1-en-2-yl-2,3,4,5,6,7,8,10a-octahydroxanthen-1-one.
| Compound Name | (6S,10aS)-6-prop-1-en-2-yl-2,3,4,5,6,7,8,10a-octahydroxanthen-1-one |
|---|---|
| PubChem CID | 11521602 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (6S,10aS)-6-prop-1-en-2-yl-2,3,4,5,6,7,8,10a-octahydroxanthen-1-one |
| SMILES | C=C(C)[C@H]1CCC2=CC3=C(CCCC3=O)O[C@H]2C1 |
| InChI | InChI=1S/C16H20O2/c1-10(2)11-6-7-12-8-13-14(17)4-3-5-15(13)18-16(12)9-11/h8,11,16H,1,3-7,9H2,2H3/t11-,16-/m0/s1 |
| InChIKey | AQOQNIQJCRXKJG-ZBEGNZNMSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|