C14H23NO — CID 115216089
2-(5-tert-butyl-N,2-dimethylanilino)ethanol (PubChem CID 115216089) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(5-tert-butyl-N,2-dimethylanilino)ethanol.
| Compound Name | 2-(5-tert-butyl-N,2-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 115216089 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(5-tert-butyl-N,2-dimethylanilino)ethanol |
| SMILES | Cc1ccc(C(C)(C)C)cc1N(C)CCO |
| InChI | InChI=1S/C14H23NO/c1-11-6-7-12(14(2,3)4)10-13(11)15(5)8-9-16/h6-7,10,16H,8-9H2,1-5H3 |
| InChIKey | XBJPMNDMWQHXGM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |