C12H17N3O — CID 115216675
3-[(1,2-dimethylbenzimidazol-5-yl)amino]propan-1-ol (PubChem CID 115216675) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-[(1,2-dimethylbenzimidazol-5-yl)amino]propan-1-ol.
| Compound Name | 3-[(1,2-dimethylbenzimidazol-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 115216675 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-[(1,2-dimethylbenzimidazol-5-yl)amino]propan-1-ol |
| SMILES | Cc1nc2cc(NCCCO)ccc2n1C |
| InChI | InChI=1S/C12H17N3O/c1-9-14-11-8-10(13-6-3-7-16)4-5-12(11)15(9)2/h4-5,8,13,16H,3,6-7H2,1-2H3 |
| InChIKey | PIEROOWXSHGPSQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|