C11H16ClNO2 — CID 115216842
3-[(2-chloro-4-methoxyphenyl)methylamino]propan-1-ol (PubChem CID 115216842) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-[(2-chloro-4-methoxyphenyl)methylamino]propan-1-ol.
| Compound Name | 3-[(2-chloro-4-methoxyphenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 115216842 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[(2-chloro-4-methoxyphenyl)methylamino]propan-1-ol |
| SMILES | COc1ccc(CNCCCO)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO2/c1-15-10-4-3-9(11(12)7-10)8-13-5-2-6-14/h3-4,7,13-14H,2,5-6,8H2,1H3 |
| InChIKey | RZNUAAGYBLKPCP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|