C18H28O — CID 11521768
(1S,3E,7E,11R)-1,4,8-trimethylbicyclo[9.4.0]pentadeca-3,7-dien-13-one (PubChem CID 11521768) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (1S,3E,7E,11R)-1,4,8-trimethylbicyclo[9.4.0]pentadeca-3,7-dien-13-one.
| Compound Name | (1S,3E,7E,11R)-1,4,8-trimethylbicyclo[9.4.0]pentadeca-3,7-dien-13-one |
|---|---|
| PubChem CID | 11521768 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (1S,3E,7E,11R)-1,4,8-trimethylbicyclo[9.4.0]pentadeca-3,7-dien-13-one |
| SMILES | C/C1=C\C[C@]2(C)CCC(=O)C[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C18H28O/c1-14-5-4-6-15(2)9-11-18(3)12-10-17(19)13-16(18)8-7-14/h5,9,16H,4,6-8,10-13H2,1-3H3/b14-5+,15-9+/t16-,18-/m1/s1 |
| InChIKey | BPENEKIBPSDOCH-RWGCPIJFSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|