C13H18FNO3 — CID 115218534
4-(4-ethoxy-3-fluoro-N-methylanilino)butanoic acid (PubChem CID 115218534) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluoro-N-methylanilino)butanoic acid.
| Compound Name | 4-(4-ethoxy-3-fluoro-N-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 115218534 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-(4-ethoxy-3-fluoro-N-methylanilino)butanoic acid |
| SMILES | CCOc1ccc(N(C)CCCC(=O)O)cc1F |
| InChI | InChI=1S/C13H18FNO3/c1-3-18-12-7-6-10(9-11(12)14)15(2)8-4-5-13(16)17/h6-7,9H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | OAPXMARHUCUFJO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|