5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid

C15H23NO3 — CID 115219065

IUPAC5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid
SMILESCOc1c(C)cc(CNCCCCC(=O)O)cc1C
InChIInChI=1S/C15H23NO3/c1-11-8-13(9-12(2)15(11)19-3)10-16-7-5-4-6-14(17)18/h8-9,16H,4-7,10H2,1-3H3,(H,17,18)
InChIKeyDIOFFQRLGYHLKK-UHFFFAOYSA-N
MW265.35 g/mol
LogP2.66
Rot. Bonds8

About 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid

5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid (PubChem CID 115219065) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid.

Molecular Properties

Compound Name5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid
PubChem CID115219065
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid
SMILESCOc1c(C)cc(CNCCCCC(=O)O)cc1C
InChIInChI=1S/C15H23NO3/c1-11-8-13(9-12(2)15(11)19-3)10-16-7-5-4-6-14(17)18/h8-9,16H,4-7,10H2,1-3H3,(H,17,18)
InChIKeyDIOFFQRLGYHLKK-UHFFFAOYSA-N
XLogP2.66
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid?
The IUPAC name of 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid (CID 115219065) is 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid.
What is the SMILES notation for 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid?
The canonical SMILES for 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid is COc1c(C)cc(CNCCCCC(=O)O)cc1C.
What is the InChIKey of 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid?
The InChIKey is DIOFFQRLGYHLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-11-8-13(9-12(2)15(11)19-3)10-16-7-5-4-6-14(17)18/h8-9,16H,4-7,10H2,1-3H3,(H,17,18).
What are the key properties of 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid?
5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid has a molecular weight of 265.35 g/mol, XLogP of 2.66, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methoxy-3,5-dimethylphenyl)methylamino]pentanoic acid is sourced from PubChem (CID 115219065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).