C13H26O4Si — CID 11521923
(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-6-methylcyclohexan-1-one (PubChem CID 11521923) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is (2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-6-methylcyclohexan-1-one.
| Compound Name | (2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 11521923 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-6-methylcyclohexan-1-one |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)C1=O |
| InChI | InChI=1S/C13H26O4Si/c1-8-7-9(11(15)12(16)10(8)14)17-18(5,6)13(2,3)4/h8-9,11-12,15-16H,7H2,1-6H3/t8-,9-,11+,12-/m1/s1 |
| InChIKey | TZUPMRBYLLPSLH-PKZYVASSSA-N |
| XLogP | 1.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|