About 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid
1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid (PubChem CID 11521935) has the molecular formula C15H16O5
and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid |
| PubChem CID | 11521935 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid |
| SMILES | COC(=O)c1c(C(=O)O)ccc2c1C(=O)CCC2(C)C |
| InChI | InChI=1S/C15H16O5/c1-15(2)7-6-10(16)12-9(15)5-4-8(13(17)18)11(12)14(19)20-3/h4-5H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | ILTRASGKEHNDAX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid (CID 11521935) is 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid is COC(=O)c1c(C(=O)O)ccc2c1C(=O)CCC2(C)C.
What is the InChIKey of 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid?
The InChIKey is ILTRASGKEHNDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-15(2)7-6-10(16)12-9(15)5-4-8(13(17)18)11(12)14(19)20-3/h4-5H,6-7H2,1-3H3,(H,17,18).
What are the key properties of 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid?
1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid has a molecular weight of 276.29 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxycarbonyl-5,5-dimethyl-8-oxo-6,7-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 11521935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).