C13H17N3O2 — CID 115219571
3-[2-(3H-benzimidazol-5-yl)ethylamino]-2-methylpropanoic acid (PubChem CID 115219571) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[2-(3H-benzimidazol-5-yl)ethylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-(3H-benzimidazol-5-yl)ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 115219571 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[2-(3H-benzimidazol-5-yl)ethylamino]-2-methylpropanoic acid |
| SMILES | CC(CNCCc1ccc2nc[nH]c2c1)C(=O)O |
| InChI | InChI=1S/C13H17N3O2/c1-9(13(17)18)7-14-5-4-10-2-3-11-12(6-10)16-8-15-11/h2-3,6,8-9,14H,4-5,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NKBYWUCFROEPBE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|