About 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid
4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid (PubChem CID 115220316) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid.
Analyze 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid?
The IUPAC name of 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid (CID 115220316) is 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid.
What is the SMILES notation for 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid?
The canonical SMILES for 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid is Cc1ccc(CNCC(C)(C)CC(=O)O)cc1C.
What is the InChIKey of 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid?
The InChIKey is AJIYMRHBIJPWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-11-5-6-13(7-12(11)2)9-16-10-15(3,4)8-14(17)18/h5-7,16H,8-10H2,1-4H3,(H,17,18).
What are the key properties of 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid?
4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid has a molecular weight of 249.35 g/mol, XLogP of 2.89, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylphenyl)methylamino]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 115220316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).