About 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid
2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 115221435) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid.
Analyze 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid (CID 115221435) is 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid is Cc1ccccc1N(C)CC1CC1C(=O)O.
What is the InChIKey of 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid?
The InChIKey is IUKKZVUQBWSSCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-9-5-3-4-6-12(9)14(2)8-10-7-11(10)13(15)16/h3-6,10-11H,7-8H2,1-2H3,(H,15,16).
What are the key properties of 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid?
2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid has a molecular weight of 219.28 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N,2-dimethylanilino)methyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 115221435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).