C17H19NO2 — CID 115221686
2-[(2-naphthalen-1-ylethylamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 115221686) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[(2-naphthalen-1-ylethylamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[(2-naphthalen-1-ylethylamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115221686 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[(2-naphthalen-1-ylethylamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1CNCCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H19NO2/c19-17(20)16-10-14(16)11-18-9-8-13-6-3-5-12-4-1-2-7-15(12)13/h1-7,14,16,18H,8-11H2,(H,19,20) |
| InChIKey | YGAALVPKIIJNOV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|